C11H14FN — CID 70323615
5-fluoro-3-propyl-2,3-dihydro-1H-indole (PubChem CID 70323615) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is 5-fluoro-3-propyl-2,3-dihydro-1H-indole.
| Compound Name | 5-fluoro-3-propyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 70323615 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 5-fluoro-3-propyl-2,3-dihydro-1H-indole |
| SMILES | CCCC1CNc2ccc(F)cc21 |
| InChI | InChI=1S/C11H14FN/c1-2-3-8-7-13-11-5-4-9(12)6-10(8)11/h4-6,8,13H,2-3,7H2,1H3 |
| InChIKey | AMPOIKZSFRGANF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |