C12H17NO — CID 124549466
(3R)-5-methoxy-3-propyl-2,3-dihydro-1H-indole (PubChem CID 124549466) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (3R)-5-methoxy-3-propyl-2,3-dihydro-1H-indole.
| Compound Name | (3R)-5-methoxy-3-propyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 124549466 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (3R)-5-methoxy-3-propyl-2,3-dihydro-1H-indole |
| SMILES | CCC[C@H]1CNc2ccc(OC)cc21 |
| InChI | InChI=1S/C12H17NO/c1-3-4-9-8-13-12-6-5-10(14-2)7-11(9)12/h5-7,9,13H,3-4,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | SADPKZOJFZCCFJ-VIFPVBQESA-N |
| XLogP | 3.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|