C13H19NO — CID 106986376
5-methoxy-3-(2-methylpropyl)-2,3-dihydro-1H-indole (PubChem CID 106986376) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 5-methoxy-3-(2-methylpropyl)-2,3-dihydro-1H-indole.
| Compound Name | 5-methoxy-3-(2-methylpropyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106986376 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 5-methoxy-3-(2-methylpropyl)-2,3-dihydro-1H-indole |
| SMILES | COc1ccc2c(c1)C(CC(C)C)CN2 |
| InChI | InChI=1S/C13H19NO/c1-9(2)6-10-8-14-13-5-4-11(15-3)7-12(10)13/h4-5,7,9-10,14H,6,8H2,1-3H3 |
| InChIKey | QRFDVQGMPPYKGZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|