C14H21N3O — CID 115004341
5-methoxy-3-(piperazin-1-ylmethyl)-2,3-dihydro-1H-indole (PubChem CID 115004341) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 5-methoxy-3-(piperazin-1-ylmethyl)-2,3-dihydro-1H-indole.
| Compound Name | 5-methoxy-3-(piperazin-1-ylmethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 115004341 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 5-methoxy-3-(piperazin-1-ylmethyl)-2,3-dihydro-1H-indole |
| SMILES | COc1ccc2c(c1)C(CN1CCNCC1)CN2 |
| InChI | InChI=1S/C14H21N3O/c1-18-12-2-3-14-13(8-12)11(9-16-14)10-17-6-4-15-5-7-17/h2-3,8,11,15-16H,4-7,9-10H2,1H3 |
| InChIKey | GSPQDGCRSXJREI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|