C14H19NO3 — CID 23652761
ethyl 3-[(3R)-5-methoxy-2,3-dihydro-1H-indol-3-yl]propanoate (PubChem CID 23652761) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is ethyl 3-[(3R)-5-methoxy-2,3-dihydro-1H-indol-3-yl]propanoate.
| Compound Name | ethyl 3-[(3R)-5-methoxy-2,3-dihydro-1H-indol-3-yl]propanoate |
|---|---|
| PubChem CID | 23652761 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | ethyl 3-[(3R)-5-methoxy-2,3-dihydro-1H-indol-3-yl]propanoate |
| SMILES | CCOC(=O)CC[C@H]1CNc2ccc(OC)cc21 |
| InChI | InChI=1S/C14H19NO3/c1-3-18-14(16)7-4-10-9-15-13-6-5-11(17-2)8-12(10)13/h5-6,8,10,15H,3-4,7,9H2,1-2H3/t10-/m0/s1 |
| InChIKey | RAWPJJUWKOOQPO-JTQLQIEISA-N |
| XLogP | 2.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|