C10H11NO2 — CID 89159810
5-methoxy-2,3-dihydro-1H-indole-3-carbaldehyde (PubChem CID 89159810) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 5-methoxy-2,3-dihydro-1H-indole-3-carbaldehyde.
| Compound Name | 5-methoxy-2,3-dihydro-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 89159810 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 5-methoxy-2,3-dihydro-1H-indole-3-carbaldehyde |
| SMILES | COc1ccc2c(c1)C(C=O)CN2 |
| InChI | InChI=1S/C10H11NO2/c1-13-8-2-3-10-9(4-8)7(6-12)5-11-10/h2-4,6-7,11H,5H2,1H3 |
| InChIKey | IIJUPEBDMFSGAJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|