C14H20N2O — CID 84627031
9-methoxy-3-methyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[c][2,7]naphthyridine (PubChem CID 84627031) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 9-methoxy-3-methyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[c][2,7]naphthyridine.
| Compound Name | 9-methoxy-3-methyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[c][2,7]naphthyridine |
|---|---|
| PubChem CID | 84627031 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 9-methoxy-3-methyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[c][2,7]naphthyridine |
| SMILES | COc1ccc2c(c1)C1CCN(C)CC1CN2 |
| InChI | InChI=1S/C14H20N2O/c1-16-6-5-12-10(9-16)8-15-14-4-3-11(17-2)7-13(12)14/h3-4,7,10,12,15H,5-6,8-9H2,1-2H3 |
| InChIKey | BQBBFIPAEJTNSG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|