C16H23NO — CID 178102694
3-(6-methoxy-2,3-dihydro-1H-inden-1-yl)-1-methylpiperidine (PubChem CID 178102694) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-(6-methoxy-2,3-dihydro-1H-inden-1-yl)-1-methylpiperidine.
| Compound Name | 3-(6-methoxy-2,3-dihydro-1H-inden-1-yl)-1-methylpiperidine |
|---|---|
| PubChem CID | 178102694 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 3-(6-methoxy-2,3-dihydro-1H-inden-1-yl)-1-methylpiperidine |
| SMILES | COc1ccc2c(c1)C(C1CCCN(C)C1)CC2 |
| InChI | InChI=1S/C16H23NO/c1-17-9-3-4-13(11-17)15-8-6-12-5-7-14(18-2)10-16(12)15/h5,7,10,13,15H,3-4,6,8-9,11H2,1-2H3 |
| InChIKey | RJOFRPVJBMWKQU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |