C14H19NO — CID 141001034
(3aS,9bS)-7-methoxy-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole (PubChem CID 141001034) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (3aS,9bS)-7-methoxy-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole.
| Compound Name | (3aS,9bS)-7-methoxy-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole |
|---|---|
| PubChem CID | 141001034 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (3aS,9bS)-7-methoxy-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole |
| SMILES | COc1ccc2c(c1)CC[C@@H]1CN(C)C[C@H]21 |
| InChI | InChI=1S/C14H19NO/c1-15-8-11-4-3-10-7-12(16-2)5-6-13(10)14(11)9-15/h5-7,11,14H,3-4,8-9H2,1-2H3/t11-,14+/m1/s1 |
| InChIKey | DCUXCNOAXIGTDZ-RISCZKNCSA-N |
| XLogP | 2.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |