C19H23NO2 — CID 10040293
(3aR,9bR)-2-[2-(furan-2-yl)ethyl]-7-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole (PubChem CID 10040293) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (3aR,9bR)-2-[2-(furan-2-yl)ethyl]-7-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole.
| Compound Name | (3aR,9bR)-2-[2-(furan-2-yl)ethyl]-7-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole |
|---|---|
| PubChem CID | 10040293 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (3aR,9bR)-2-[2-(furan-2-yl)ethyl]-7-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole |
| SMILES | COc1ccc2c(c1)CC[C@H]1CN(CCc3ccco3)C[C@@H]21 |
| InChI | InChI=1S/C19H23NO2/c1-21-17-6-7-18-14(11-17)4-5-15-12-20(13-19(15)18)9-8-16-3-2-10-22-16/h2-3,6-7,10-11,15,19H,4-5,8-9,12-13H2,1H3/t15-,19+/m0/s1 |
| InChIKey | YXHUXVWWHRHLMX-HNAYVOBHSA-N |
| XLogP | 3.49 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |