C13H17N — CID 10261870
(3aR,9bR)-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole (PubChem CID 10261870) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (3aR,9bR)-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole.
| Compound Name | (3aR,9bR)-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole |
|---|---|
| PubChem CID | 10261870 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (3aR,9bR)-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole |
| SMILES | CN1C[C@@H]2CCc3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C13H17N/c1-14-8-11-7-6-10-4-2-3-5-12(10)13(11)9-14/h2-5,11,13H,6-9H2,1H3/t11-,13+/m0/s1 |
| InChIKey | JMLXYPJMPDOEKO-WCQYABFASA-N |
| XLogP | 2.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |