C20H23N — CID 15751777
(4aR,10bS)-3-benzyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline (PubChem CID 15751777) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is (4aR,10bS)-3-benzyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline.
| Compound Name | (4aR,10bS)-3-benzyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline |
|---|---|
| PubChem CID | 15751777 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (4aR,10bS)-3-benzyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline |
| SMILES | c1ccc(CN2CC[C@@H]3c4ccccc4CC[C@H]3C2)cc1 |
| InChI | InChI=1S/C20H23N/c1-2-6-16(7-3-1)14-21-13-12-20-18(15-21)11-10-17-8-4-5-9-19(17)20/h1-9,18,20H,10-15H2/t18-,20-/m0/s1 |
| InChIKey | NQALPKAYZMMWEC-ICSRJNTNSA-N |
| XLogP | 4.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |