C16H21N — CID 67942351
(4aS,10bR)-3-prop-2-enyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline (PubChem CID 67942351) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (4aS,10bR)-3-prop-2-enyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline.
| Compound Name | (4aS,10bR)-3-prop-2-enyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline |
|---|---|
| PubChem CID | 67942351 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (4aS,10bR)-3-prop-2-enyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline |
| SMILES | C=CCN1CC[C@H]2c3ccccc3CC[C@@H]2C1 |
| InChI | InChI=1S/C16H21N/c1-2-10-17-11-9-16-14(12-17)8-7-13-5-3-4-6-15(13)16/h2-6,14,16H,1,7-12H2/t14-,16-/m1/s1 |
| InChIKey | LQVKLIWEHOSMFM-GDBMZVCRSA-N |
| XLogP | 3.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|