C13H14N2 — CID 56833326
2-prop-2-enyl-3,4-dihydro-1H-isoquinoline-1-carbonitrile (PubChem CID 56833326) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-prop-2-enyl-3,4-dihydro-1H-isoquinoline-1-carbonitrile.
| Compound Name | 2-prop-2-enyl-3,4-dihydro-1H-isoquinoline-1-carbonitrile |
|---|---|
| PubChem CID | 56833326 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2-prop-2-enyl-3,4-dihydro-1H-isoquinoline-1-carbonitrile |
| SMILES | C=CCN1CCc2ccccc2C1C#N |
| InChI | InChI=1S/C13H14N2/c1-2-8-15-9-7-11-5-3-4-6-12(11)13(15)10-14/h2-6,13H,1,7-9H2 |
| InChIKey | BOYGWFKJPYFHML-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|