methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate

C12H12N2O2 — CID 7039088

IUPACmethyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate
SMILESCOC(=O)N1CCc2ccccc2[C@@H]1C#N
InChIInChI=1S/C12H12N2O2/c1-16-12(15)14-7-6-9-4-2-3-5-10(9)11(14)8-13/h2-5,11H,6-7H2,1H3/t11-/m0/s1
InChIKeyRITVWJGKVLKGHU-NSHDSACASA-N
MW216.24 g/mol
LogP1.88
Rot. Bonds

About methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate

methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 7039088) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate.

Molecular Properties

Compound Namemethyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate
PubChem CID7039088
Molecular FormulaC12H12N2O2
Molecular Weight216.24 g/mol
Exact Mass216.09
IUPAC Namemethyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate
SMILESCOC(=O)N1CCc2ccccc2[C@@H]1C#N
InChIInChI=1S/C12H12N2O2/c1-16-12(15)14-7-6-9-4-2-3-5-10(9)11(14)8-13/h2-5,11H,6-7H2,1H3/t11-/m0/s1
InChIKeyRITVWJGKVLKGHU-NSHDSACASA-N
XLogP1.88
TPSA53.33 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.24
LogP ≤ 51.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The IUPAC name of methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate (CID 7039088) is methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate.
What is the SMILES notation for methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The canonical SMILES for methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate is COC(=O)N1CCc2ccccc2[C@@H]1C#N.
What is the InChIKey of methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The InChIKey is RITVWJGKVLKGHU-NSHDSACASA-N. The full InChI is InChI=1S/C12H12N2O2/c1-16-12(15)14-7-6-9-4-2-3-5-10(9)11(14)8-13/h2-5,11H,6-7H2,1H3/t11-/m0/s1.
What are the key properties of methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate?
methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate has a molecular weight of 216.24 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate is sourced from PubChem (CID 7039088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).