About methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate
methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 7039088) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate.
Analyze methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The IUPAC name of methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate (CID 7039088) is methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate.
What is the SMILES notation for methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The canonical SMILES for methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate is COC(=O)N1CCc2ccccc2[C@@H]1C#N.
What is the InChIKey of methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The InChIKey is RITVWJGKVLKGHU-NSHDSACASA-N. The full InChI is InChI=1S/C12H12N2O2/c1-16-12(15)14-7-6-9-4-2-3-5-10(9)11(14)8-13/h2-5,11H,6-7H2,1H3/t11-/m0/s1.
What are the key properties of methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate?
methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate has a molecular weight of 216.24 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1R)-1-cyano-3,4-dihydro-1H-isoquinoline-2-carboxylate is sourced from PubChem (CID 7039088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).