C17H17NO2 — CID 67079072
methyl (1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 67079072) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is methyl (1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | methyl (1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 67079072 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | methyl (1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | COC(=O)N1CCc2ccccc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c1-20-17(19)18-12-11-13-7-5-6-10-15(13)16(18)14-8-3-2-4-9-14/h2-10,16H,11-12H2,1H3/t16-/m0/s1 |
| InChIKey | DSYZPHZZKBSSHQ-INIZCTEOSA-N |
| XLogP | 3.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |