C19H19NO2 — CID 67145723
prop-2-enyl (1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 67145723) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is prop-2-enyl (1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | prop-2-enyl (1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 67145723 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | prop-2-enyl (1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | C=CCOC(=O)N1CCc2ccccc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H19NO2/c1-2-14-22-19(21)20-13-12-15-8-6-7-11-17(15)18(20)16-9-4-3-5-10-16/h2-11,18H,1,12-14H2/t18-/m0/s1 |
| InChIKey | CESVTYXZOJHVJD-SFHVURJKSA-N |
| XLogP | 3.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|