C22H20N2O — CID 135391620
(1S)-N,1-diphenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 135391620) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is (1S)-N,1-diphenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | (1S)-N,1-diphenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 135391620 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (1S)-N,1-diphenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCc2ccccc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H20N2O/c25-22(23-19-12-5-2-6-13-19)24-16-15-17-9-7-8-14-20(17)21(24)18-10-3-1-4-11-18/h1-14,21H,15-16H2,(H,23,25)/t21-/m0/s1 |
| InChIKey | ANGTYJQSMCLDLI-NRFANRHFSA-N |
| XLogP | 4.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |