C24H24N2O — CID 92767297
(1S)-N,1-bis(4-methylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 92767297) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is (1S)-N,1-bis(4-methylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | (1S)-N,1-bis(4-methylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 92767297 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | (1S)-N,1-bis(4-methylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCc3ccccc3[C@@H]2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O/c1-17-7-11-20(12-8-17)23-22-6-4-3-5-19(22)15-16-26(23)24(27)25-21-13-9-18(2)10-14-21/h3-14,23H,15-16H2,1-2H3,(H,25,27)/t23-/m0/s1 |
| InChIKey | ITBHQRCZQXQDFK-QHCPKHFHSA-N |
| XLogP | 5.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |