C23H16F5NO — CID 46095510
[1-(4-methylphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 46095510) has the molecular formula C23H16F5NO and a molecular weight of 417.38 g/mol. Its IUPAC name is [1-(4-methylphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | [1-(4-methylphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 46095510 |
| Molecular Formula | C23H16F5NO |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [1-(4-methylphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | Cc1ccc(C2c3ccccc3CCN2C(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C23H16F5NO/c1-12-6-8-14(9-7-12)22-15-5-3-2-4-13(15)10-11-29(22)23(30)16-17(24)19(26)21(28)20(27)18(16)25/h2-9,22H,10-11H2,1H3 |
| InChIKey | SSTNXHOOCSFMKZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|