C20H22FNO2 — CID 170615705
ethane;1-[1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]propane-1,2-dione (PubChem CID 170615705) has the molecular formula C20H22FNO2 and a molecular weight of 327.40 g/mol. Its IUPAC name is ethane;1-[1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]propane-1,2-dione.
| Compound Name | ethane;1-[1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 170615705 |
| Molecular Formula | C20H22FNO2 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | ethane;1-[1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]propane-1,2-dione |
| SMILES | CC.CC(=O)C(=O)N1CCc2ccccc2C1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FNO2.C2H6/c1-12(21)18(22)20-11-10-13-4-2-3-5-16(13)17(20)14-6-8-15(19)9-7-14;1-2/h2-9,17H,10-11H2,1H3;1-2H3 |
| InChIKey | GRWOXSHJMJOTGJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|