C25H27FN2O2 — CID 175722692
(2E)-2-(1-azabicyclo[2.2.2]octan-3-ylidene)-1-[1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-methoxyethanone (PubChem CID 175722692) has the molecular formula C25H27FN2O2 and a molecular weight of 406.50 g/mol. Its IUPAC name is (2E)-2-(1-azabicyclo[2.2.2]octan-3-ylidene)-1-[1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-methoxyethanone.
| Compound Name | (2E)-2-(1-azabicyclo[2.2.2]octan-3-ylidene)-1-[1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 175722692 |
| Molecular Formula | C25H27FN2O2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (2E)-2-(1-azabicyclo[2.2.2]octan-3-ylidene)-1-[1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-methoxyethanone |
| SMILES | CO/C(C(=O)N1CCc2ccccc2C1c1ccc(F)cc1)=C1/CN2CCC1CC2 |
| InChI | InChI=1S/C25H27FN2O2/c1-30-24(22-16-27-13-10-18(22)11-14-27)25(29)28-15-12-17-4-2-3-5-21(17)23(28)19-6-8-20(26)9-7-19/h2-9,18,23H,10-16H2,1H3/b24-22- |
| InChIKey | FSVYUXUEDIYPFX-GYHWCHFESA-N |
| XLogP | 3.93 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|