C18H13F4NO3 — CID 155390478
(2,2,2-trifluoroacetyl) (1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 155390478) has the molecular formula C18H13F4NO3 and a molecular weight of 367.30 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) (1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 155390478 |
| Molecular Formula | C18H13F4NO3 |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(OC(=O)C(F)(F)F)N1CCc2ccccc2[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H13F4NO3/c19-13-7-5-12(6-8-13)15-14-4-2-1-3-11(14)9-10-23(15)17(25)26-16(24)18(20,21)22/h1-8,15H,9-10H2/t15-/m0/s1 |
| InChIKey | VMIGDXRBOWDSTO-HNNXBMFYSA-N |
| XLogP | 4.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|