C16H13IN2 — CID 139081239
(1S)-2-(2-iodophenyl)-3,4-dihydro-1H-isoquinoline-1-carbonitrile (PubChem CID 139081239) has the molecular formula C16H13IN2 and a molecular weight of 360.20 g/mol. Its IUPAC name is (1S)-2-(2-iodophenyl)-3,4-dihydro-1H-isoquinoline-1-carbonitrile.
| Compound Name | (1S)-2-(2-iodophenyl)-3,4-dihydro-1H-isoquinoline-1-carbonitrile |
|---|---|
| PubChem CID | 139081239 |
| Molecular Formula | C16H13IN2 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | (1S)-2-(2-iodophenyl)-3,4-dihydro-1H-isoquinoline-1-carbonitrile |
| SMILES | N#C[C@@H]1c2ccccc2CCN1c1ccccc1I |
| InChI | InChI=1S/C16H13IN2/c17-14-7-3-4-8-15(14)19-10-9-12-5-1-2-6-13(12)16(19)11-18/h1-8,16H,9-10H2/t16-/m1/s1 |
| InChIKey | LBRPXFREQSOIBC-MRXNPFEDSA-N |
| XLogP | 3.92 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|