C15H14BrN — CID 146165240
1-bromo-2-phenyl-3,4-dihydro-1H-isoquinoline (PubChem CID 146165240) has the molecular formula C15H14BrN and a molecular weight of 288.19 g/mol. Its IUPAC name is 1-bromo-2-phenyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 1-bromo-2-phenyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 146165240 |
| Molecular Formula | C15H14BrN |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 1-bromo-2-phenyl-3,4-dihydro-1H-isoquinoline |
| SMILES | BrC1c2ccccc2CCN1c1ccccc1 |
| InChI | InChI=1S/C15H14BrN/c16-15-14-9-5-4-6-12(14)10-11-17(15)13-7-2-1-3-8-13/h1-9,15H,10-11H2 |
| InChIKey | YPEJNCQDABKWQB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|