C18H18BrN — CID 164898422
2-(4-bromophenyl)-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline (PubChem CID 164898422) has the molecular formula C18H18BrN and a molecular weight of 328.25 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(4-bromophenyl)-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 164898422 |
| Molecular Formula | C18H18BrN |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 2-(4-bromophenyl)-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline |
| SMILES | C=CCC1c2ccccc2CCN1c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H18BrN/c1-2-5-18-17-7-4-3-6-14(17)12-13-20(18)16-10-8-15(19)9-11-16/h2-4,6-11,18H,1,5,12-13H2 |
| InChIKey | LHBZTZSARAVPDS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|