C20H20BrNO2 — CID 170648836
benzyl 6-bromo-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 170648836) has the molecular formula C20H20BrNO2 and a molecular weight of 386.29 g/mol. Its IUPAC name is benzyl 6-bromo-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | benzyl 6-bromo-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 170648836 |
| Molecular Formula | C20H20BrNO2 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | benzyl 6-bromo-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | C=CCC1c2ccc(Br)cc2CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H20BrNO2/c1-2-6-19-18-10-9-17(21)13-16(18)11-12-22(19)20(23)24-14-15-7-4-3-5-8-15/h2-5,7-10,13,19H,1,6,11-12,14H2 |
| InChIKey | VSKWMLLOILKSCB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|