C23H23BrN2O4 — CID 129280315
tert-butyl (1R)-6-bromo-1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 129280315) has the molecular formula C23H23BrN2O4 and a molecular weight of 471.35 g/mol. Its IUPAC name is tert-butyl (1R)-6-bromo-1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (1R)-6-bromo-1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 129280315 |
| Molecular Formula | C23H23BrN2O4 |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | tert-butyl (1R)-6-bromo-1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(Br)ccc2[C@@H]1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H23BrN2O4/c1-23(2,3)30-22(29)25-11-10-14-12-15(24)8-9-16(14)19(25)13-26-20(27)17-6-4-5-7-18(17)21(26)28/h4-9,12,19H,10-11,13H2,1-3H3/t19-/m0/s1 |
| InChIKey | WFQDLPYZEDSFGB-IBGZPJMESA-N |
| XLogP | 4.58 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|