C24H27BrN2O3 — CID 175898913
tert-butyl 1-[3-(3-bromo-5-cyanophenoxy)propyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 175898913) has the molecular formula C24H27BrN2O3 and a molecular weight of 471.40 g/mol. Its IUPAC name is tert-butyl 1-[3-(3-bromo-5-cyanophenoxy)propyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 1-[3-(3-bromo-5-cyanophenoxy)propyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 175898913 |
| Molecular Formula | C24H27BrN2O3 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | tert-butyl 1-[3-(3-bromo-5-cyanophenoxy)propyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccccc2C1CCCOc1cc(Br)cc(C#N)c1 |
| InChI | InChI=1S/C24H27BrN2O3/c1-24(2,3)30-23(28)27-11-10-18-7-4-5-8-21(18)22(27)9-6-12-29-20-14-17(16-26)13-19(25)15-20/h4-5,7-8,13-15,22H,6,9-12H2,1-3H3 |
| InChIKey | ITCPGPJNDBYWQX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|