C24H28F3NO3 — CID 162537266
tert-butyl 1-(3-phenoxypropyl)-5-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 162537266) has the molecular formula C24H28F3NO3 and a molecular weight of 435.49 g/mol. Its IUPAC name is tert-butyl 1-(3-phenoxypropyl)-5-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 1-(3-phenoxypropyl)-5-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 162537266 |
| Molecular Formula | C24H28F3NO3 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | tert-butyl 1-(3-phenoxypropyl)-5-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(cccc2C(F)(F)F)C1CCCOc1ccccc1 |
| InChI | InChI=1S/C24H28F3NO3/c1-23(2,3)31-22(29)28-15-14-18-19(11-7-12-20(18)24(25,26)27)21(28)13-8-16-30-17-9-5-4-6-10-17/h4-7,9-12,21H,8,13-16H2,1-3H3 |
| InChIKey | LUEZAAHBYDGUBT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|