C18H21NO5 — CID 11024043
1-O-benzyl 3-O-ethyl 4-oxo-5-prop-2-enylpyrrolidine-1,3-dicarboxylate (PubChem CID 11024043) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-O-benzyl 3-O-ethyl 4-oxo-5-prop-2-enylpyrrolidine-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-ethyl 4-oxo-5-prop-2-enylpyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 11024043 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-O-benzyl 3-O-ethyl 4-oxo-5-prop-2-enylpyrrolidine-1,3-dicarboxylate |
| SMILES | C=CCC1C(=O)C(C(=O)OCC)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H21NO5/c1-3-8-15-16(20)14(17(21)23-4-2)11-19(15)18(22)24-12-13-9-6-5-7-10-13/h3,5-7,9-10,14-15H,1,4,8,11-12H2,2H3 |
| InChIKey | CIXOQTGALGYSLA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|