C37H39NO5 — CID 102144017
benzyl (2S,3S,4S,5R)-3,4,5-tris(phenylmethoxy)-2-prop-2-enylpiperidine-1-carboxylate (PubChem CID 102144017) has the molecular formula C37H39NO5 and a molecular weight of 577.72 g/mol. Its IUPAC name is benzyl (2S,3S,4S,5R)-3,4,5-tris(phenylmethoxy)-2-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | benzyl (2S,3S,4S,5R)-3,4,5-tris(phenylmethoxy)-2-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 102144017 |
| Molecular Formula | C37H39NO5 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | benzyl (2S,3S,4S,5R)-3,4,5-tris(phenylmethoxy)-2-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CC[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H39NO5/c1-2-15-33-35(41-26-30-18-9-4-10-19-30)36(42-27-31-20-11-5-12-21-31)34(40-25-29-16-7-3-8-17-29)24-38(33)37(39)43-28-32-22-13-6-14-23-32/h2-14,16-23,33-36H,1,15,24-28H2/t33-,34+,35-,36-/m0/s1 |
| InChIKey | YYHDIQHCMDAWAZ-WLPVSNDTSA-N |
| XLogP | 7.34 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|