C37H41NO4 — CID 71658430
(3R,4R,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)-1-prop-2-enylazepane (PubChem CID 71658430) has the molecular formula C37H41NO4 and a molecular weight of 563.74 g/mol. Its IUPAC name is (3R,4R,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)-1-prop-2-enylazepane.
| Compound Name | (3R,4R,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)-1-prop-2-enylazepane |
|---|---|
| PubChem CID | 71658430 |
| Molecular Formula | C37H41NO4 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | (3R,4R,5R,6R)-3,4,5,6-tetrakis(phenylmethoxy)-1-prop-2-enylazepane |
| SMILES | C=CCN1C[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C37H41NO4/c1-2-23-38-24-34(39-26-30-15-7-3-8-16-30)36(41-28-32-19-11-5-12-20-32)37(42-29-33-21-13-6-14-22-33)35(25-38)40-27-31-17-9-4-10-18-31/h2-22,34-37H,1,23-29H2/t34-,35-,36-,37-/m1/s1 |
| InChIKey | CHGLMFQRKQARQM-LPYGTTGFSA-N |
| XLogP | 6.83 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|