C19H29NO — CID 58732890
2-ethyl-3,4-dimethyl-5-phenylmethoxy-1-prop-2-enylpiperidine (PubChem CID 58732890) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 2-ethyl-3,4-dimethyl-5-phenylmethoxy-1-prop-2-enylpiperidine.
| Compound Name | 2-ethyl-3,4-dimethyl-5-phenylmethoxy-1-prop-2-enylpiperidine |
|---|---|
| PubChem CID | 58732890 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 2-ethyl-3,4-dimethyl-5-phenylmethoxy-1-prop-2-enylpiperidine |
| SMILES | C=CCN1CC(OCc2ccccc2)C(C)C(C)C1CC |
| InChI | InChI=1S/C19H29NO/c1-5-12-20-13-19(16(4)15(3)18(20)6-2)21-14-17-10-8-7-9-11-17/h5,7-11,15-16,18-19H,1,6,12-14H2,2-4H3 |
| InChIKey | QWIJYIXTJODNJW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|