C14H20OSe — CID 161051476
(2R,3S,4S)-2-ethyl-3-methyl-4-phenylmethoxyselenolane (PubChem CID 161051476) has the molecular formula C14H20OSe and a molecular weight of 283.27 g/mol. Its IUPAC name is (2R,3S,4S)-2-ethyl-3-methyl-4-phenylmethoxyselenolane.
| Compound Name | (2R,3S,4S)-2-ethyl-3-methyl-4-phenylmethoxyselenolane |
|---|---|
| PubChem CID | 161051476 |
| Molecular Formula | C14H20OSe |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (2R,3S,4S)-2-ethyl-3-methyl-4-phenylmethoxyselenolane |
| SMILES | CC[C@H]1[Se]C[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C14H20OSe/c1-3-14-11(2)13(10-16-14)15-9-12-7-5-4-6-8-12/h4-8,11,13-14H,3,9-10H2,1-2H3/t11-,13+,14+/m0/s1 |
| InChIKey | CHBPHIRTZLMHLG-IACUBPJLSA-N |
| XLogP | 3.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|