C26H28O4Se — CID 11059943
(3R,4R,5S)-3,4,5-tris(phenylmethoxy)selenan-2-ol (PubChem CID 11059943) has the molecular formula C26H28O4Se and a molecular weight of 483.47 g/mol. Its IUPAC name is (3R,4R,5S)-3,4,5-tris(phenylmethoxy)selenan-2-ol.
| Compound Name | (3R,4R,5S)-3,4,5-tris(phenylmethoxy)selenan-2-ol |
|---|---|
| PubChem CID | 11059943 |
| Molecular Formula | C26H28O4Se |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | (3R,4R,5S)-3,4,5-tris(phenylmethoxy)selenan-2-ol |
| SMILES | OC1[Se]C[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H28O4Se/c27-26-25(30-18-22-14-8-3-9-15-22)24(29-17-21-12-6-2-7-13-21)23(19-31-26)28-16-20-10-4-1-5-11-20/h1-15,23-27H,16-19H2/t23-,24-,25-,26?/m1/s1 |
| InChIKey | RRTOLEHAULSGBX-NITSXXPLSA-N |
| XLogP | 4.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|