C27H30O4 — CID 23245876
[(1S,2S,3R,4S)-2,3,4-tris(phenylmethoxy)cyclopentyl]methanol (PubChem CID 23245876) has the molecular formula C27H30O4 and a molecular weight of 418.53 g/mol. Its IUPAC name is [(1S,2S,3R,4S)-2,3,4-tris(phenylmethoxy)cyclopentyl]methanol.
| Compound Name | [(1S,2S,3R,4S)-2,3,4-tris(phenylmethoxy)cyclopentyl]methanol |
|---|---|
| PubChem CID | 23245876 |
| Molecular Formula | C27H30O4 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [(1S,2S,3R,4S)-2,3,4-tris(phenylmethoxy)cyclopentyl]methanol |
| SMILES | OC[C@@H]1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H30O4/c28-17-24-16-25(29-18-21-10-4-1-5-11-21)27(31-20-23-14-8-3-9-15-23)26(24)30-19-22-12-6-2-7-13-22/h1-15,24-28H,16-20H2/t24-,25-,26-,27+/m0/s1 |
| InChIKey | ZMSKNQPIHQTTHV-YIPNQBBMSA-N |
| XLogP | 4.75 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |