C23H26O4 — CID 10021813
[(1R,2R,4S,5S,6S,7S,8R)-7,8-bis(phenylmethoxy)-3-oxatricyclo[4.3.0.02,4]nonan-5-yl]methanol (PubChem CID 10021813) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is [(1R,2R,4S,5S,6S,7S,8R)-7,8-bis(phenylmethoxy)-3-oxatricyclo[4.3.0.02,4]nonan-5-yl]methanol.
| Compound Name | [(1R,2R,4S,5S,6S,7S,8R)-7,8-bis(phenylmethoxy)-3-oxatricyclo[4.3.0.02,4]nonan-5-yl]methanol |
|---|---|
| PubChem CID | 10021813 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [(1R,2R,4S,5S,6S,7S,8R)-7,8-bis(phenylmethoxy)-3-oxatricyclo[4.3.0.02,4]nonan-5-yl]methanol |
| SMILES | OC[C@H]1[C@@H]2O[C@@H]2[C@@H]2C[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C23H26O4/c24-12-18-20-17(21-22(18)27-21)11-19(25-13-15-7-3-1-4-8-15)23(20)26-14-16-9-5-2-6-10-16/h1-10,17-24H,11-14H2/t17-,18-,19-,20+,21-,22+,23-/m1/s1 |
| InChIKey | HKHAKJGWFCMJSM-IISWQVLISA-N |
| XLogP | 3.18 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|