C27H28O4 — CID 10811839
(1S,2R,4S,5R)-2,4-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexane (PubChem CID 10811839) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is (1S,2R,4S,5R)-2,4-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexane.
| Compound Name | (1S,2R,4S,5R)-2,4-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 10811839 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (1S,2R,4S,5R)-2,4-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexane |
| SMILES | c1ccc(COCC2[C@@H](OCc3ccccc3)[C@@H]3O[C@@H]3[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H28O4/c1-4-10-20(11-5-1)16-28-19-23-24(29-17-21-12-6-2-7-13-21)26-27(31-26)25(23)30-18-22-14-8-3-9-15-22/h1-15,23-27H,16-19H2/t23?,24-,25+,26+,27- |
| InChIKey | GTQDNFUWHKNYGE-WOGJFKDVSA-N |
| XLogP | 4.77 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|