C32H32O3 — CID 10994244
(2S,3S,4S,5R)-2,5-diphenyl-3,4-bis(phenylmethoxymethyl)oxolane (PubChem CID 10994244) has the molecular formula C32H32O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2,5-diphenyl-3,4-bis(phenylmethoxymethyl)oxolane.
| Compound Name | (2S,3S,4S,5R)-2,5-diphenyl-3,4-bis(phenylmethoxymethyl)oxolane |
|---|---|
| PubChem CID | 10994244 |
| Molecular Formula | C32H32O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | (2S,3S,4S,5R)-2,5-diphenyl-3,4-bis(phenylmethoxymethyl)oxolane |
| SMILES | c1ccc(COC[C@@H]2[C@@H](COCc3ccccc3)[C@H](c3ccccc3)O[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C32H32O3/c1-5-13-25(14-6-1)21-33-23-29-30(24-34-22-26-15-7-2-8-16-26)32(28-19-11-4-12-20-28)35-31(29)27-17-9-3-10-18-27/h1-20,29-32H,21-24H2/t29-,30-,31-,32+/m1/s1 |
| InChIKey | QLBMOCWTRJYPBF-ANLCFORVSA-N |
| XLogP | 7.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |