C21H24O2 — CID 166976209
(1S,2S,3S,4R)-2,3-bis(phenylmethoxymethyl)bicyclo[2.1.0]pentane (PubChem CID 166976209) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is (1S,2S,3S,4R)-2,3-bis(phenylmethoxymethyl)bicyclo[2.1.0]pentane.
| Compound Name | (1S,2S,3S,4R)-2,3-bis(phenylmethoxymethyl)bicyclo[2.1.0]pentane |
|---|---|
| PubChem CID | 166976209 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (1S,2S,3S,4R)-2,3-bis(phenylmethoxymethyl)bicyclo[2.1.0]pentane |
| SMILES | c1ccc(COC[C@@H]2[C@@H](COCc3ccccc3)[C@@H]3C[C@H]23)cc1 |
| InChI | InChI=1S/C21H24O2/c1-3-7-16(8-4-1)12-22-14-20-18-11-19(18)21(20)15-23-13-17-9-5-2-6-10-17/h1-10,18-21H,11-15H2/t18-,19+,20-,21-/m0/s1 |
| InChIKey | HIRYKJYPBWYNJQ-WOZUAGRISA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |