C13H18O3 — CID 12717277
4-(phenylmethoxymethyl)cyclopentane-1,2-diol (PubChem CID 12717277) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 4-(phenylmethoxymethyl)cyclopentane-1,2-diol.
| Compound Name | 4-(phenylmethoxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 12717277 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 4-(phenylmethoxymethyl)cyclopentane-1,2-diol |
| SMILES | OC1CC(COCc2ccccc2)CC1O |
| InChI | InChI=1S/C13H18O3/c14-12-6-11(7-13(12)15)9-16-8-10-4-2-1-3-5-10/h1-5,11-15H,6-9H2 |
| InChIKey | WZABEFWFEGXKMG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |