C13H20N2O — CID 57481680
trans-(1R,2R)-4-(phenylmethoxymethyl)cyclopentane-1,2-diamine (PubChem CID 57481680) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is trans-(1R,2R)-4-(phenylmethoxymethyl)cyclopentane-1,2-diamine.
| Compound Name | trans-(1R,2R)-4-(phenylmethoxymethyl)cyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 57481680 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | trans-(1R,2R)-4-(phenylmethoxymethyl)cyclopentane-1,2-diamine |
| SMILES | N[C@@H]1CC(COCc2ccccc2)C[C@H]1N |
| InChI | InChI=1S/C13H20N2O/c14-12-6-11(7-13(12)15)9-16-8-10-4-2-1-3-5-10/h1-5,11-13H,6-9,14-15H2/t12-,13-/m1/s1 |
| InChIKey | KNARSWOEUBOMRJ-CHWSQXEVSA-N |
| XLogP | 1.27 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |