C34H34O4 — CID 132606757
(1S,2R,4R,4aS,10bS)-2-phenyl-1,4-bis(phenylmethoxymethyl)-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene (PubChem CID 132606757) has the molecular formula C34H34O4 and a molecular weight of 506.64 g/mol. Its IUPAC name is (1S,2R,4R,4aS,10bS)-2-phenyl-1,4-bis(phenylmethoxymethyl)-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene.
| Compound Name | (1S,2R,4R,4aS,10bS)-2-phenyl-1,4-bis(phenylmethoxymethyl)-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene |
|---|---|
| PubChem CID | 132606757 |
| Molecular Formula | C34H34O4 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | (1S,2R,4R,4aS,10bS)-2-phenyl-1,4-bis(phenylmethoxymethyl)-1,2,4,4a,6,10b-hexahydropyrano[3,4-c]isochromene |
| SMILES | c1ccc(COC[C@@H]2[C@H]3c4ccccc4CO[C@@H]3[C@@H](COCc3ccccc3)O[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C34H34O4/c1-4-12-25(13-5-1)20-35-23-30-32-29-19-11-10-18-28(29)22-37-34(32)31(24-36-21-26-14-6-2-7-15-26)38-33(30)27-16-8-3-9-17-27/h1-19,30-34H,20-24H2/t30-,31-,32-,33+,34-/m1/s1 |
| InChIKey | ZBOQGCNHPQDMGY-VIYJWPFNSA-N |
| XLogP | 6.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |