C28H30O5S — CID 46919724
(1R,3R,3aS,11aR)-1-[(4-methoxyphenyl)methoxymethyl]-3-(4-methylphenyl)sulfanyl-1,3,3a,5,10,11a-hexahydrofuro[3,4-c][2,5]benzodioxocine (PubChem CID 46919724) has the molecular formula C28H30O5S and a molecular weight of 478.61 g/mol. Its IUPAC name is (1R,3R,3aS,11aR)-1-[(4-methoxyphenyl)methoxymethyl]-3-(4-methylphenyl)sulfanyl-1,3,3a,5,10,11a-hexahydrofuro[3,4-c][2,5]benzodioxocine.
| Compound Name | (1R,3R,3aS,11aR)-1-[(4-methoxyphenyl)methoxymethyl]-3-(4-methylphenyl)sulfanyl-1,3,3a,5,10,11a-hexahydrofuro[3,4-c][2,5]benzodioxocine |
|---|---|
| PubChem CID | 46919724 |
| Molecular Formula | C28H30O5S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (1R,3R,3aS,11aR)-1-[(4-methoxyphenyl)methoxymethyl]-3-(4-methylphenyl)sulfanyl-1,3,3a,5,10,11a-hexahydrofuro[3,4-c][2,5]benzodioxocine |
| SMILES | COc1ccc(COC[C@H]2O[C@H](Sc3ccc(C)cc3)[C@H]3OCc4ccccc4CO[C@@H]32)cc1 |
| InChI | InChI=1S/C28H30O5S/c1-19-7-13-24(14-8-19)34-28-27-26(31-16-21-5-3-4-6-22(21)17-32-27)25(33-28)18-30-15-20-9-11-23(29-2)12-10-20/h3-14,25-28H,15-18H2,1-2H3/t25-,26-,27+,28-/m1/s1 |
| InChIKey | IMPSCUNLPKJIHN-ZZXHUEHTSA-N |
| XLogP | 5.52 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |