C36H40O6S — CID 10864943
(2R,3R,4S,5S,6R)-3-[(4-methoxyphenyl)methoxy]-2-methylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 10864943) has the molecular formula C36H40O6S and a molecular weight of 600.78 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-3-[(4-methoxyphenyl)methoxy]-2-methylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3R,4S,5S,6R)-3-[(4-methoxyphenyl)methoxy]-2-methylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 10864943 |
| Molecular Formula | C36H40O6S |
| Molecular Weight | 600.78 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | (2R,3R,4S,5S,6R)-3-[(4-methoxyphenyl)methoxy]-2-methylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H](COCc3ccccc3)O[C@@H]2SC)cc1 |
| InChI | InChI=1S/C36H40O6S/c1-37-31-20-18-30(19-21-31)25-41-35-34(40-24-29-16-10-5-11-17-29)33(39-23-28-14-8-4-9-15-28)32(42-36(35)43-2)26-38-22-27-12-6-3-7-13-27/h3-21,32-36H,22-26H2,1-2H3/t32-,33+,34+,35-,36-/m1/s1 |
| InChIKey | UWTMXWWRUYGCCR-FGZSBDNFSA-N |
| XLogP | 7.06 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.78 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |