C55H60O10S — CID 146030621
[(3S,4S,6S)-6-[(2S,4S,5S)-2-methylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 146030621) has the molecular formula C55H60O10S and a molecular weight of 913.14 g/mol. Its IUPAC name is [(3S,4S,6S)-6-[(2S,4S,5S)-2-methylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(3S,4S,6S)-6-[(2S,4S,5S)-2-methylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 146030621 |
| Molecular Formula | C55H60O10S |
| Molecular Weight | 913.14 g/mol |
| Exact Mass | 912.39 |
| IUPAC Name | [(3S,4S,6S)-6-[(2S,4S,5S)-2-methylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | CS[C@@H]1OC(COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1O[C@@H]1OC(CO)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C55H60O10S/c1-66-55-53(51(61-37-44-28-16-6-17-29-44)49(59-35-42-24-12-4-13-25-42)47(64-55)39-57-33-40-20-8-2-9-21-40)65-54-52(62-38-45-30-18-7-19-31-45)50(60-36-43-26-14-5-15-27-43)48(46(32-56)63-54)58-34-41-22-10-3-11-23-41/h2-31,46-56H,32-39H2,1H3/t46?,47?,48-,49-,50-,51-,52?,53?,54-,55-/m0/s1 |
| InChIKey | QWYQUUMVZZVLBK-DVACAPNWSA-N |
| XLogP | 9.32 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.14 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |