C35H38O6S — CID 91873062
(3S,4S,5R,6R)-2-methylsulfanyloxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 91873062) has the molecular formula C35H38O6S and a molecular weight of 586.75 g/mol. Its IUPAC name is (3S,4S,5R,6R)-2-methylsulfanyloxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (3S,4S,5R,6R)-2-methylsulfanyloxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 91873062 |
| Molecular Formula | C35H38O6S |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | (3S,4S,5R,6R)-2-methylsulfanyloxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | CSOC1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H38O6S/c1-42-41-35-34(39-25-30-20-12-5-13-21-30)33(38-24-29-18-10-4-11-19-29)32(37-23-28-16-8-3-9-17-28)31(40-35)26-36-22-27-14-6-2-7-15-27/h2-21,31-35H,22-26H2,1H3/t31-,32-,33+,34+,35?/m1/s1 |
| InChIKey | BGOWYHWVBGTGFG-DLCPRKGNSA-N |
| XLogP | 6.98 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|