C37H40O6S — CID 101352641
1-[(2S,3R,4R,5S,6R)-2-(4-methoxyphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]propan-2-one (PubChem CID 101352641) has the molecular formula C37H40O6S and a molecular weight of 612.79 g/mol. Its IUPAC name is 1-[(2S,3R,4R,5S,6R)-2-(4-methoxyphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]propan-2-one.
| Compound Name | 1-[(2S,3R,4R,5S,6R)-2-(4-methoxyphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]propan-2-one |
|---|---|
| PubChem CID | 101352641 |
| Molecular Formula | C37H40O6S |
| Molecular Weight | 612.79 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | 1-[(2S,3R,4R,5S,6R)-2-(4-methoxyphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]propan-2-one |
| SMILES | COc1ccc(S[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2CC(C)=O)cc1 |
| InChI | InChI=1S/C37H40O6S/c1-27(38)22-33-35(41-24-29-14-8-4-9-15-29)36(42-25-30-16-10-5-11-17-30)34(26-40-23-28-12-6-3-7-13-28)43-37(33)44-32-20-18-31(39-2)19-21-32/h3-21,33-37H,22-26H2,1-2H3/t33-,34-,35-,36-,37+/m1/s1 |
| InChIKey | NKPDCRANFHXUAR-QRZOQVTHSA-N |
| XLogP | 7.50 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.79 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |