C24H28O6 — CID 11704291
(1'R,3'aS,4S,11'aR)-2,2-dimethyl-1'-(phenylmethoxymethyl)spiro[1,3-dioxolane-4,3'-3a,5,10,11a-tetrahydro-1H-furo[3,4-c][2,5]benzodioxocine] (PubChem CID 11704291) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is (1'R,3'aS,4S,11'aR)-2,2-dimethyl-1'-(phenylmethoxymethyl)spiro[1,3-dioxolane-4,3'-3a,5,10,11a-tetrahydro-1H-furo[3,4-c][2,5]benzodioxocine].
| Compound Name | (1'R,3'aS,4S,11'aR)-2,2-dimethyl-1'-(phenylmethoxymethyl)spiro[1,3-dioxolane-4,3'-3a,5,10,11a-tetrahydro-1H-furo[3,4-c][2,5]benzodioxocine] |
|---|---|
| PubChem CID | 11704291 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (1'R,3'aS,4S,11'aR)-2,2-dimethyl-1'-(phenylmethoxymethyl)spiro[1,3-dioxolane-4,3'-3a,5,10,11a-tetrahydro-1H-furo[3,4-c][2,5]benzodioxocine] |
| SMILES | CC1(C)OC[C@]2(O[C@H](COCc3ccccc3)[C@H]3OCc4ccccc4CO[C@@H]32)O1 |
| InChI | InChI=1S/C24H28O6/c1-23(2)28-16-24(30-23)22-21(26-13-18-10-6-7-11-19(18)14-27-22)20(29-24)15-25-12-17-8-4-3-5-9-17/h3-11,20-22H,12-16H2,1-2H3/t20-,21-,22+,24+/m1/s1 |
| InChIKey | IQSULUQPGIHPEI-SVPADUAOSA-N |
| XLogP | 3.57 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |